Z-Gly-Ile-OH structure
|
Common Name | Z-Gly-Ile-OH | ||
|---|---|---|---|---|
| CAS Number | 20807-11-8 | Molecular Weight | 322.35600 | |
| Density | 1.203g/cm3 | Boiling Point | 582ºC at 760 mmHg | |
| Molecular Formula | C16H22N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 305.8ºC | |
| Name | 1-chloro-3-[6-(3-chloro-2-hydroxypropoxy)hexoxy]propan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.203g/cm3 |
|---|---|
| Boiling Point | 582ºC at 760 mmHg |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.35600 |
| Flash Point | 305.8ºC |
| Exact Mass | 322.15300 |
| PSA | 104.73000 |
| LogP | 2.31010 |
| Vapour Pressure | 2.17E-14mmHg at 25°C |
| Index of Refraction | 1.534 |
| InChIKey | YPXHSERXWVIZGK-FZMZJTMJSA-N |
| SMILES | CCC(C)C(NC(=O)CNC(=O)OCc1ccccc1)C(=O)O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| EINECS 243-778-9 |
| Z-Gly-L-Ile-OH |
| Z-Gly-Ile-OH |
| N-benzyloxycarbonylglycyl-L-isoleucine |