cyclopenten-1-yl-[dimethyl(phenyl)silyl]methanone structure
|
Common Name | cyclopenten-1-yl-[dimethyl(phenyl)silyl]methanone | ||
|---|---|---|---|---|
| CAS Number | 207925-84-6 | Molecular Weight | 230.37800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | cyclopenten-1-yl-[dimethyl(phenyl)silyl]methanone |
|---|
| Molecular Formula | C14H18OSi |
|---|---|
| Molecular Weight | 230.37800 |
| Exact Mass | 230.11300 |
| PSA | 17.07000 |
| LogP | 2.82060 |
| InChIKey | GQVWMZWDMFLNDI-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C(=O)C1=CCCC1)c1ccccc1 |
|
~%
cyclopenten-1-y... CAS#:207925-84-6 |
| Literature: Takeda, Kei; Nakajima, Akemi; Takeda, Mika; Okamoto, Yasushi; Sato, Taku; Yoshii, Eiichi; Koizumi, Toru; Shiro, Motoo Journal of the American Chemical Society, 1998 , vol. 120, # 20 p. 4947 - 4959 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |