1,3-bis[3-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]urea structure
|
Common Name | 1,3-bis[3-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]urea | ||
|---|---|---|---|---|
| CAS Number | 20782-50-7 | Molecular Weight | 408.46000 | |
| Density | 1.39g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C19H24N10O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3-bis[3-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]urea |
|---|
| Density | 1.39g/cm3 |
|---|---|
| Molecular Formula | C19H24N10O |
| Molecular Weight | 408.46000 |
| Exact Mass | 408.21300 |
| PSA | 193.14000 |
| LogP | 4.21320 |
| InChIKey | RTQKJDTXNVTSDW-LYXAAFRTSA-N |
| SMILES | CC(=NN=C(N)N)c1cccc(NC(=O)Nc2cccc(C(C)=NN=C(N)N)c2)c1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |