methyl 2-(phenylcarbamoylmethoxy)benzoate
Modify Date: 2025-09-21 10:20:29
methyl 2-(phenylcarbamoylmethoxy)benzoate structure
|
Common Name | methyl 2-(phenylcarbamoylmethoxy)benzoate | ||
|---|---|---|---|---|
| CAS Number | 20745-67-9 | Molecular Weight | 285.29500 | |
| Density | 1.246g/cm3 | Boiling Point | 507.6ºC at 760 mmHg | |
| Molecular Formula | C16H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 260.8ºC | |
| Name | methyl 2-(2-anilino-2-oxoethoxy)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.246g/cm3 |
|---|---|
| Boiling Point | 507.6ºC at 760 mmHg |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.29500 |
| Flash Point | 260.8ºC |
| Exact Mass | 285.10000 |
| PSA | 64.63000 |
| LogP | 2.56370 |
| Vapour Pressure | 1.99E-10mmHg at 25°C |
| Index of Refraction | 1.602 |
| InChIKey | LDBZUMACBAAIBS-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccccc1OCC(=O)Nc1ccccc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| methyl 2-(phenylcarbamoylmethoxy)benzoate |