tert-Butyl (R)-(4,4,4-trifluoro-1-hydroxybutan-2-yl)carbamate
Modify Date: 2026-07-28 10:58:07
tert-Butyl (R)-(4,4,4-trifluoro-1-hydroxybutan-2-yl)carbamate structure
|
Common Name | tert-Butyl (R)-(4,4,4-trifluoro-1-hydroxybutan-2-yl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 207118-12-5 | Molecular Weight | 243.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H16F3NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-Butyl (R)-(4,4,4-trifluoro-1-hydroxybutan-2-yl)carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H16F3NO3 |
|---|---|
| Molecular Weight | 243.22 |
| InChIKey | YQODVUUZNPHLQT-ZCFIWIBFSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CO)CC(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of tert-Butyl (R)-(4,4,4-trifluoro-1-hydroxybutan-2-yl)carbamate? |
| A: SMILES notation of tert-Butyl (R)-(4,4,4-trifluoro-1-hydroxybutan-2-yl)carbamate is CC(C)(C)OC(=O)NC(CO)CC(F)(F)F. |
| Q: What is the molecular formula of tert-Butyl (R)-(4,4,4-trifluoro-1-hydroxybutan-2-yl)carbamate? |
| A: Molecular formula of tert-Butyl (R)-(4,4,4-trifluoro-1-hydroxybutan-2-yl)carbamate is C9H16F3NO3. |
| Q: What is the CAS number of tert-Butyl (R)-(4,4,4-trifluoro-1-hydroxybutan-2-yl)carbamate? |
| A: CAS number of tert-Butyl (R)-(4,4,4-trifluoro-1-hydroxybutan-2-yl)carbamate is 207118-12-5. |
| Q: What is the InChIKey of tert-Butyl (R)-(4,4,4-trifluoro-1-hydroxybutan-2-yl)carbamate? |
| A: InChIKey of tert-Butyl (R)-(4,4,4-trifluoro-1-hydroxybutan-2-yl)carbamate is YQODVUUZNPHLQT-ZCFIWIBFSA-N. |
| Q: What is the English name of tert-Butyl (R)-(4,4,4-trifluoro-1-hydroxybutan-2-yl)carbamate? |
| A: The English name of tert-Butyl (R)-(4,4,4-trifluoro-1-hydroxybutan-2-yl)carbamate is tert-Butyl (R)-(4,4,4-trifluoro-1-hydroxybutan-2-yl)carbamate. |
| Q: What is the Chinese name of 207118-12-5? |
| A: Chinese name of 207118-12-5 is 207118-12-5. |
| Q: What is the molecular weight of tert-Butyl (R)-(4,4,4-trifluoro-1-hydroxybutan-2-yl)carbamate? |
| A: Molecular weight of tert-Butyl (R)-(4,4,4-trifluoro-1-hydroxybutan-2-yl)carbamate is 243.22. |