FGN849
Modify Date: 2025-12-18 10:16:10
FGN849 structure
|
Common Name | FGN849 | ||
|---|---|---|---|---|
| CAS Number | 2069250-01-5 | Molecular Weight | 707.77 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C42H37N5O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of FGN849FGN849 is the catabolite of DGN549-L ADCs[1]. |
| Name | FGN849 |
|---|
| Description | FGN849 is the catabolite of DGN549-L ADCs[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C42H37N5O6 |
|---|---|
| Molecular Weight | 707.77 |
| InChIKey | MPZZBNVMDYKZRF-KYJUHHDHSA-N |
| SMILES | COc1cc2c(cc1OCc1cc(N)cc(COc3cc4c(cc3OC)C(=O)N3c5ccccc5CC3CN4)c1)N=CC1Cc3ccccc3N1C2=O |