bis(2-fluoro-2,2-dinitro-ethyl) carbonate structure
|
Common Name | bis(2-fluoro-2,2-dinitro-ethyl) carbonate | ||
|---|---|---|---|---|
| CAS Number | 20677-77-4 | Molecular Weight | 334.10200 | |
| Density | 1.825g/cm3 | Boiling Point | 357.9ºC at 760 mmHg | |
| Molecular Formula | C5H4F2N4O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.3ºC | |
| Name | bis(2-fluoro-2,2-dinitroethyl) carbonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.825g/cm3 |
|---|---|
| Boiling Point | 357.9ºC at 760 mmHg |
| Molecular Formula | C5H4F2N4O11 |
| Molecular Weight | 334.10200 |
| Flash Point | 170.3ºC |
| Exact Mass | 333.98400 |
| PSA | 218.81000 |
| LogP | 1.58580 |
| Vapour Pressure | 2.64E-05mmHg at 25°C |
| Index of Refraction | 1.491 |
| InChIKey | BPMXMXFLNKOZJI-UHFFFAOYSA-N |
| SMILES | O=C(OCC(F)([N+](=O)[O-])[N+](=O)[O-])OCC(F)([N+](=O)[O-])[N+](=O)[O-] |
| HS Code | 2920909090 |
|---|
| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-Fluoro-2,2-dinitroethyl-carbonat |
| EINECS 243-961-3 |