5-Methyl-4-phenyl-o-anisidine structure
|
Common Name | 5-Methyl-4-phenyl-o-anisidine | ||
|---|---|---|---|---|
| CAS Number | 206761-76-4 | Molecular Weight | 213.27500 | |
| Density | 1.081g/cm3 | Boiling Point | 325.6ºC at 760 mmHg | |
| Molecular Formula | C14H15NO | Melting Point | 65ºC | |
| MSDS | N/A | Flash Point | 148.6ºC | |
| Name | 5-Methyl-4-phenyl-o-anisidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.081g/cm3 |
|---|---|
| Boiling Point | 325.6ºC at 760 mmHg |
| Melting Point | 65ºC |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.27500 |
| Flash Point | 148.6ºC |
| Exact Mass | 213.11500 |
| PSA | 35.25000 |
| LogP | 3.83400 |
| Vapour Pressure | 0.000227mmHg at 25°C |
| Index of Refraction | 1.59 |
| InChIKey | NLPFRHHIACJMBY-UHFFFAOYSA-N |
| SMILES | COc1cc(-c2ccccc2)c(C)cc1N |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2922199090 |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-methyl-4-phenyl-o-anisidine |