4-(4-acetamidophenoxy)-4-oxo-butanoic acid structure
|
Common Name | 4-(4-acetamidophenoxy)-4-oxo-butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 20675-25-6 | Molecular Weight | 251.23500 | |
| Density | 1.337g/cm3 | Boiling Point | 530ºC at 760mmHg | |
| Molecular Formula | C12H13NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 274.3ºC | |
| Name | 4-(4-Acetamidophenoxy)-4-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.337g/cm3 |
|---|---|
| Boiling Point | 530ºC at 760mmHg |
| Molecular Formula | C12H13NO5 |
| Molecular Weight | 251.23500 |
| Flash Point | 274.3ºC |
| Exact Mass | 251.07900 |
| PSA | 96.19000 |
| LogP | 2.06470 |
| Vapour Pressure | 4.61E-12mmHg at 25°C |
| Index of Refraction | 1.582 |
| InChIKey | WBMMAKGUOXWWKZ-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(OC(=O)CCC(=O)O)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Acetamino-hydrogensuccinyloxy-benzol |
| 4-[4-(acetylamino)phenoxy]-4-oxobutanoic acid |
| (p-Acetamino-phenyl)-succinat |
| Acetaminophen hemisuccinate |
| Paracetamol hemisuccinate |
| Mono(4-(acetylamino)phenyl) butanedioate |