Fmoc-2,6-dimethyl-L-tyrosine structure
|
Common Name | Fmoc-2,6-dimethyl-L-tyrosine | ||
|---|---|---|---|---|
| CAS Number | 206060-54-0 | Molecular Weight | 431.480 | |
| Density | 1.290 | Boiling Point | 691.2±55.0 °C at 760 mmHg | |
| Molecular Formula | C26H25NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 371.8±31.5 °C | |
| Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-hydroxy-2,6-dimethylphenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.290 |
|---|---|
| Boiling Point | 691.2±55.0 °C at 760 mmHg |
| Molecular Formula | C26H25NO5 |
| Molecular Weight | 431.480 |
| Flash Point | 371.8±31.5 °C |
| Exact Mass | 431.173279 |
| PSA | 99.35000 |
| LogP | 5.59 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Index of Refraction | 1.636 |
| InChIKey | RHSSAHKTHNKPGU-DEOSSOPVSA-N |
| SMILES | Cc1cc(O)cc(C)c1CC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-2,6-dimethyl-L-tyrosine |
| Fmoc-2,6-dimethyl-L-tyrosine |
| (S)-N-Fmoc-2,6-Dimethyltyrosine |
| L-Tyrosine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-2,6-dimethyl- |