Methyl 5-Methyl-2-Nitrobenzoate structure
|
Common Name | Methyl 5-Methyl-2-Nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 20587-30-8 | Molecular Weight | 195.17200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Methyl 5-methyl-2-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H9NO4 |
|---|---|
| Molecular Weight | 195.17200 |
| Exact Mass | 195.05300 |
| PSA | 72.12000 |
| LogP | 2.21300 |
| InChIKey | KFOICDVZQKFCGM-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(C)ccc1[N+](=O)[O-] |
| HS Code | 2916399090 |
|---|
|
~79%
Methyl 5-Methyl... CAS#:20587-30-8 |
| Literature: US2004/214798 A1, ; Page 17 ; |
|
~10%
Methyl 5-Methyl... CAS#:20587-30-8 |
| Literature: Journal of Heterocyclic Chemistry, , vol. 21, p. 1807 - 1816 |
|
~%
Methyl 5-Methyl... CAS#:20587-30-8 |
| Literature: EP2103601 A1, ; Page/Page column 35 ; |
|
~%
Methyl 5-Methyl... CAS#:20587-30-8 |
| Literature: Chemische Berichte, , vol. 42, p. 433 |
|
~%
Methyl 5-Methyl... CAS#:20587-30-8 |
| Literature: Recueil des Travaux Chimiques des Pays-Bas, , vol. 20, p. 162 |
| Precursor 6 | |
|---|---|
| DownStream 9 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3-(Ethoxycarbonyl)-4-nitrotoluene |
| 5-Methyl-2-nitrobenzoic Acid Methyl Ester |
| methyl-5-methyl-2-nitrobenzoate |
| METHYL 5-METHYL-2-NITROBENZOATE |
| AR3260 |
| 5-methyl-2-nitro-benzoic acid methyl ester |
| 6-Nitro-m-toluic Acid Methyl Ester |
| Methyl 6-Nitro-m-toluate |
| 5-Methyl-2-nitro-benzoesaeure-methylester |