6-[2,2-bis(hydroxymethyl)butoxy]-6-oxohexanoic acid
Modify Date: 2025-09-12 20:33:40
![6-[2,2-bis(hydroxymethyl)butoxy]-6-oxohexanoic acid Structure](https://image.chemsrc.com/caspic/241/20563-11-5.png)
6-[2,2-bis(hydroxymethyl)butoxy]-6-oxohexanoic acid structure
|
Common Name | 6-[2,2-bis(hydroxymethyl)butoxy]-6-oxohexanoic acid | ||
|---|---|---|---|---|
| CAS Number | 20563-11-5 | Molecular Weight | 262.29900 | |
| Density | 1.193g/cm3 | Boiling Point | 413.3ºC at 760mmHg | |
| Molecular Formula | C12H22O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-[2,2-bis(hydroxymethyl)butoxy]-6-oxohexanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.193g/cm3 |
|---|---|
| Boiling Point | 413.3ºC at 760mmHg |
| Molecular Formula | C12H22O6 |
| Molecular Weight | 262.29900 |
| Exact Mass | 262.14200 |
| PSA | 104.06000 |
| LogP | 0.55560 |
| Vapour Pressure | 1.47E-08mmHg at 25°C |
| Index of Refraction | 1.494 |
| InChIKey | VQYGZOOQRFNLFW-UHFFFAOYSA-N |
| SMILES | CCC(CO)(CO)COC(=O)CCCCC(=O)O |
| HS Code | 2918990090 |
|---|
|
~%
6-[2,2-bis(hydr... CAS#:20563-11-5 |
| Literature: Schoellner,R.; Loehnert,P. Journal fuer Praktische Chemie (Leipzig), 1968 , vol. 38, p. 162 - 167 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Mono-<2.2-dihydroxymethyl-butyl>-adipat |
| EINECS 243-881-9 |
| (2,2-bis(hydroxymethyl)butyl) hydrogen adipate |
| Trimethylolpropan-adipat |