Fmoc-PEG3-Ala-Ala-Asn(Trt)-PAB
Modify Date: 2025-08-29 21:21:12
Fmoc-PEG3-Ala-Ala-Asn(Trt)-PAB structure
|
Common Name | Fmoc-PEG3-Ala-Ala-Asn(Trt)-PAB | ||
|---|---|---|---|---|
| CAS Number | 2055042-69-6 | Molecular Weight | 1047.20 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C60H66N6O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Fmoc-PEG3-Ala-Ala-Asn(Trt)-PABFmoc-PEG3-Ala-Ala-Asn(Trt)-PAB is a cleavable 3 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | Fmoc-PEG3-Ala-Ala-Asn(Trt)-PAB |
|---|
| Description | Fmoc-PEG3-Ala-Ala-Asn(Trt)-PAB is a cleavable 3 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker[1]. |
| References |
| Molecular Formula | C60H66N6O11 |
|---|---|
| Molecular Weight | 1047.20 |
| InChIKey | SGPBGTLVZPOASW-XKMSCPINSA-N |
| SMILES | CC(NC(=O)CCOCCOCCOCCNC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NC(C)C(=O)NC(CC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)Nc1ccc(CO)cc1 |