2-(3,4-dichlorophenyl)-4,4-diethoxy-3-oxo-butanenitrile structure
|
Common Name | 2-(3,4-dichlorophenyl)-4,4-diethoxy-3-oxo-butanenitrile | ||
|---|---|---|---|---|
| CAS Number | 20535-52-8 | Molecular Weight | 316.18000 | |
| Density | 1.267g/cm3 | Boiling Point | 422.7ºC at 760 mmHg | |
| Molecular Formula | C14H15Cl2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.5ºC | |
| Name | 2-(3,4-dichlorophenyl)-4,4-diethoxy-3-oxobutanenitrile |
|---|
| Density | 1.267g/cm3 |
|---|---|
| Boiling Point | 422.7ºC at 760 mmHg |
| Molecular Formula | C14H15Cl2NO3 |
| Molecular Weight | 316.18000 |
| Flash Point | 209.5ºC |
| Exact Mass | 315.04300 |
| PSA | 59.32000 |
| LogP | 3.56878 |
| Vapour Pressure | 2.36E-07mmHg at 25°C |
| Index of Refraction | 1.527 |
| InChIKey | GEPRVHZZEOLEFW-UHFFFAOYSA-N |
| SMILES | CCOC(OCC)C(=O)C(C#N)c1ccc(Cl)c(Cl)c1 |
|
~%
2-(3,4-dichloro... CAS#:20535-52-8 |
| Literature: Baker; Huang; Meyer Jr. Journal of medicinal chemistry, 1968 , vol. 11, # 3 p. 475 - 482 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |