bis(4-chloro-2-nitrophenyl) disulfide structure
|
Common Name | bis(4-chloro-2-nitrophenyl) disulfide | ||
|---|---|---|---|---|
| CAS Number | 2050-66-0 | Molecular Weight | 377.223 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 476.9±45.0 °C at 760 mmHg | |
| Molecular Formula | C12H6Cl2N2O4S2 | Melting Point | 214.0 to 218.0 °C | |
| MSDS | N/A | Flash Point | 242.2±28.7 °C | |
| Name | 4-chloro-1-[(4-chloro-2-nitrophenyl)disulfanyl]-2-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 476.9±45.0 °C at 760 mmHg |
| Melting Point | 214.0 to 218.0 °C |
| Molecular Formula | C12H6Cl2N2O4S2 |
| Molecular Weight | 377.223 |
| Flash Point | 242.2±28.7 °C |
| Exact Mass | 375.914612 |
| PSA | 142.24000 |
| LogP | 5.23 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.730 |
| HS Code | 2930909090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,2'-Dinitro-4,4'-dichloro diphenyl disufide |
| Disulfide, bis(4-chloro-2-nitrophenyl) |
| 2,2'-Dinitro-4,4'-dichlor-diphenyl-disulfid |
| 4,4'-Dichlor-2,2'-dinitro-diphenyldisulfid |
| 1,1'-Disulfanediylbis(4-chloro-2-nitrobenzene) |
| di4-chloro-2-nitrophenyl disulfide |
| bis(4-chloro-2-nitrophenyl) disulfide |
| 4-Chloro-1-[(4-chloro-2-nitrophenyl)disulfanyl]-2-nitrobenzene |
| 4-CHLORO-2-NITROPHENYL DISULFIDE |