2,2-Dimethylbut-3-ynoic acid benzyl ester structure
|
Common Name | 2,2-Dimethylbut-3-ynoic acid benzyl ester | ||
|---|---|---|---|---|
| CAS Number | 204588-77-2 | Molecular Weight | 202.24900 | |
| Density | 1.052g/cm3 | Boiling Point | 280.4ºC at 760 mmHg | |
| Molecular Formula | C13H14O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 112.6ºC | |
| Name | benzyl 2,2-dimethylbut-3-ynoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.052g/cm3 |
|---|---|
| Boiling Point | 280.4ºC at 760 mmHg |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.24900 |
| Flash Point | 112.6ºC |
| Exact Mass | 202.09900 |
| PSA | 26.30000 |
| LogP | 2.38920 |
| Vapour Pressure | 0.00378mmHg at 25°C |
| Index of Refraction | 1.521 |
| InChIKey | IVGCYRWSEREWFF-UHFFFAOYSA-N |
| SMILES | C#CC(C)(C)C(=O)OCc1ccccc1 |
| HS Code | 2916190090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2916190090 |
|---|---|
| Summary | 2916190090 unsaturated acyclic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| benzyl 2,2-dimethyl-3-butynoate |
| 2,2-DIMETHYL-BUT-3-YNOIC ACID BENZYL ESTER |
| 2,2-Dimethyl-3-Butynoic Acid Phenylmethyl Ester |
| benzyl 2,2-dimethyl-but-3-ynoate |
| 2,2-dimethyl-3-butynoic acid benzyl ester |