5-amino-4-methyl-2-nitrobenzoic acid structure
|
Common Name | 5-amino-4-methyl-2-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 204254-63-7 | Molecular Weight | 196.16000 | |
| Density | 1.482g/cm3 | Boiling Point | 490.9ºC at 760 mmHg | |
| Molecular Formula | C8H8N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.7ºC | |
| Name | 5-amino-4-methyl-2-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.482g/cm3 |
|---|---|
| Boiling Point | 490.9ºC at 760 mmHg |
| Molecular Formula | C8H8N2O4 |
| Molecular Weight | 196.16000 |
| Flash Point | 250.7ºC |
| Exact Mass | 196.04800 |
| PSA | 109.14000 |
| LogP | 2.28800 |
| Vapour Pressure | 1.88E-10mmHg at 25°C |
| Index of Refraction | 1.658 |
| InChIKey | XWONHRIVUKCQFF-UHFFFAOYSA-N |
| SMILES | Cc1cc([N+](=O)[O-])c(C(=O)O)cc1N |
| HS Code | 2922499990 |
|---|
|
~%
5-amino-4-methy... CAS#:204254-63-7 |
| Literature: Justus Liebigs Annalen der Chemie, , vol. 266, p. 223,227 |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 5-amino-4-methyl-2-nitro-benzoic acid |
| Benzoicacid,5-amino-4-methyl-2-nitro |
| 2-nitro-5-amino-4-methylbenzoic acid |
| 5-Amino-4-methyl-2-nitro-benzoesaeure |
| 6-Nitro-3-amino-p-toluylsaeure |