ethyl 8,9-dimethoxy-2-methyl-1-(morpholin-4-ylmethyl)-5,6-dihydropyrrolo[2,1-a]isoquinoline-3-carboxylate structure
|
Common Name | ethyl 8,9-dimethoxy-2-methyl-1-(morpholin-4-ylmethyl)-5,6-dihydropyrrolo[2,1-a]isoquinoline-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 20353-60-0 | Molecular Weight | 414.49500 | |
| Density | 1.25g/cm3 | Boiling Point | 577.8ºC at 760 mmHg | |
| Molecular Formula | C23H30N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 303.3ºC | |
| Name | ethyl 8,9-dimethoxy-2-methyl-1-(morpholin-4-ylmethyl)-5,6-dihydropyrrolo[2,1-a]isoquinoline-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 577.8ºC at 760 mmHg |
| Molecular Formula | C23H30N2O5 |
| Molecular Weight | 414.49500 |
| Flash Point | 303.3ºC |
| Exact Mass | 414.21500 |
| PSA | 62.16000 |
| LogP | 2.98360 |
| Vapour Pressure | 2.38E-13mmHg at 25°C |
| Index of Refraction | 1.593 |
| InChIKey | UUQNBTZCLBNQKR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(C)c(CN2CCOCC2)c2n1CCc1cc(OC)c(OC)cc1-2 |
|
~%
ethyl 8,9-dimet... CAS#:20353-60-0 |
| Literature: Casagrande,C. et al. Journal of Medicinal Chemistry, 1968 , vol. 11, # 4 p. 765 - 770 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-Morpholinomethyl-2-methyl-8,9-dimethoxy-5,6-dihydro-pyrrolo<2.1-a>isochinolin-3-carbonsaeureethylester |