2-(Diisopropylcarbamoyl)benzoic acid structure
|
Common Name | 2-(Diisopropylcarbamoyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 20320-39-2 | Molecular Weight | 249.30600 | |
| Density | 1.112g/cm3 | Boiling Point | 414.8ºC at 760mmHg | |
| Molecular Formula | C14H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.7ºC | |
| Name | 2-[di(propan-2-yl)carbamoyl]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.112g/cm3 |
|---|---|
| Boiling Point | 414.8ºC at 760mmHg |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.30600 |
| Flash Point | 204.7ºC |
| Exact Mass | 249.13600 |
| PSA | 57.61000 |
| LogP | 2.64380 |
| Vapour Pressure | 1.27E-07mmHg at 25°C |
| Index of Refraction | 1.537 |
| InChIKey | PZSITMBIVNJHKF-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(=O)c1ccccc1C(=O)O)C(C)C |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N,N-diisopropyl-phthalamic acid |
| Phthalamic acid,N,N-diisopropyl |
| N,N-Diisopropyl-phthalamidsaeure |