3-bromo-6-(4-chlorophenyl)-4-methylsulfanylpyran-2-one
Modify Date: 2025-08-26 16:24:36
3-bromo-6-(4-chlorophenyl)-4-methylsulfanylpyran-2-one structure
|
Common Name | 3-bromo-6-(4-chlorophenyl)-4-methylsulfanylpyran-2-one | ||
|---|---|---|---|---|
| CAS Number | 203171-92-0 | Molecular Weight | 331.61300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8BrClO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-bromo-6-(4-chlorophenyl)-4-methylsulfanylpyran-2-one |
|---|
| Molecular Formula | C12H8BrClO2S |
|---|---|
| Molecular Weight | 331.61300 |
| Exact Mass | 329.91200 |
| PSA | 55.51000 |
| LogP | 4.44460 |
| InChIKey | WTIVSRTXJLISCP-UHFFFAOYSA-N |
| SMILES | CSc1cc(-c2ccc(Cl)cc2)oc(=O)c1Br |
|
~%
3-bromo-6-(4-ch... CAS#:203171-92-0 |
| Literature: Ram, Vishnu J.; Haque, Navedul; Nath, Mahendra; Singh, Sunil K.; Hussaini, Falak A.; Tripathi; Shoeb Bioorganic and Medicinal Chemistry Letters, 1997 , vol. 7, # 24 p. 3149 - 3152 |
|
~%
3-bromo-6-(4-ch... CAS#:203171-92-0 |
| Literature: Ram, Vishnu J.; Haque, Navedul; Nath, Mahendra; Singh, Sunil K.; Hussaini, Falak A.; Tripathi; Shoeb Bioorganic and Medicinal Chemistry Letters, 1997 , vol. 7, # 24 p. 3149 - 3152 |
|
~%
3-bromo-6-(4-ch... CAS#:203171-92-0 |
| Literature: Ram, Vishnu J.; Haque, Navedul; Nath, Mahendra; Singh, Sunil K.; Hussaini, Falak A.; Tripathi; Shoeb Bioorganic and Medicinal Chemistry Letters, 1997 , vol. 7, # 24 p. 3149 - 3152 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |