(5-methylfuran-2-yl)oxy-tri(propan-2-yl)silane
Modify Date: 2025-09-29 15:26:50
(5-methylfuran-2-yl)oxy-tri(propan-2-yl)silane structure
|
Common Name | (5-methylfuran-2-yl)oxy-tri(propan-2-yl)silane | ||
|---|---|---|---|---|
| CAS Number | 203131-20-8 | Molecular Weight | 254.44100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H26O2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (5-methylfuran-2-yl)oxy-tri(propan-2-yl)silane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H26O2Si |
|---|---|
| Molecular Weight | 254.44100 |
| Exact Mass | 254.17000 |
| PSA | 22.37000 |
| LogP | 5.14230 |
| InChIKey | QHWSSAAHNHGDEN-UHFFFAOYSA-N |
| SMILES | Cc1ccc(O[Si](C(C)C)(C(C)C)C(C)C)o1 |
|
~%
(5-methylfuran-... CAS#:203131-20-8 |
| Literature: Martin, Stephen F.; Barr, Kenneth J.; Smith, Dudley W.; Bur, Scott K. Journal of the American Chemical Society, 1999 , vol. 121, # 30 p. 6990 - 6997 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Silane,tris(1-methylethyl)[(5-methyl-2-furanyl)oxy] |
| 5-methyl-2-triisopropylsilyloxyfuran |