Laninamivir structure
|
Common Name | Laninamivir | ||
|---|---|---|---|---|
| CAS Number | 203120-17-6 | Molecular Weight | 346.34 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H22N4O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of LaninamivirLaninamivir (R 125489) is a potent influenza neuraminidase (NA) inhibitor with IC50s of 0.90 nM, 1.83 nM and 3.12 nM for avian H12N5 NA (N5), pH1N1 N1 NA (p09N1) and A/RI/5+/1957 H2N2 N2 (p57N2), respectively[1]. |
| Name | (2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-2-[(1R,2R)-2,3-dihydroxy-1-methoxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Laninamivir (R 125489) is a potent influenza neuraminidase (NA) inhibitor with IC50s of 0.90 nM, 1.83 nM and 3.12 nM for avian H12N5 NA (N5), pH1N1 N1 NA (p09N1) and A/RI/5+/1957 H2N2 N2 (p57N2), respectively[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: 0.90 nM (N5), 1.83 nM (p09N1), 3.12 nM (p57N2)[1] |
| In Vitro | Laninamivir inhibits efficiently common oseltamivir-resistant viruses, including those with the ubiquitous His274Tyr substitution[1]. Laninamivir is potent against p57N2, p09N1 and N5 with a similar binding mode to Zanamivir[1]. |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Molecular Formula | C13H22N4O7 |
| Molecular Weight | 346.34 |
| Exact Mass | 346.148834 |
| PSA | 190.71000 |
| LogP | -3.06 |
| Index of Refraction | 1.634 |
| InChIKey | QNRRHYPPQFELSF-CNYIRLTGSA-N |
| SMILES | COC(C(O)CO)C1OC(C(=O)O)=CC(N=C(N)N)C1NC(C)=O |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 5-acetamido-4-guanidino-2,3,4,5-tetradeoxy-7-O-methyl-D-glycero-D-galacto-non-2-enopyranosoic acid |
| Laninamivir |
| CS-8958 |
| (6R)-5-Acetamido-2,6-anhydro-4-carbamimidamido-3,4,5-trideoxy-6-[(1R,2R)-2,3-dihydroxy-1-methoxypropyl]-L-threo-hex-2-enonic acid |
| D-glycero-D-galacto-Non-2-enonic acid, 5-(acetylamino)-4-[(aminoiminomethyl)amino]-2,6-anhydro-3,4,5-trideoxy-7-O-methyl- |