(3-BROMOPROPYL)TRIPHENYLPHOSPHONIUMBROMIDE
Modify Date: 2025-09-18 12:59:43
(3-BROMOPROPYL)TRIPHENYLPHOSPHONIUMBROMIDE structure
|
Common Name | (3-BROMOPROPYL)TRIPHENYLPHOSPHONIUMBROMIDE | ||
|---|---|---|---|---|
| CAS Number | 20292-28-8 | Molecular Weight | 262.68800 | |
| Density | 1.301g/cm3 | Boiling Point | 435.1ºC at 760mmHg | |
| Molecular Formula | C14H11ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.9ºC | |
| Name | 2-(2-chloro-4-phenylphenoxy)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.301g/cm3 |
|---|---|
| Boiling Point | 435.1ºC at 760mmHg |
| Molecular Formula | C14H11ClO3 |
| Molecular Weight | 262.68800 |
| Flash Point | 216.9ºC |
| Exact Mass | 262.04000 |
| PSA | 46.53000 |
| LogP | 3.47040 |
| Vapour Pressure | 2.43E-08mmHg at 25°C |
| Index of Refraction | 1.595 |
| InChIKey | UQRLYDDCHNEFAP-UHFFFAOYSA-N |
| SMILES | O=C(O)COc1ccc(-c2ccccc2)cc1Cl |
| HS Code | 2918990090 |
|---|
|
~%
(3-BROMOPROPYL)... CAS#:20292-28-8 |
| Literature: Nametkin; Melnikow; Basskakow Zhurnal Obshchei Khimii, 1949 , vol. 19, p. 1151,1155, 1156 Chem.Abstr., 1950 , p. 1072 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Phenyl-2-chlor-phenoxyessigsaeure |