1-(3H-inden-1-yl)-3-(3-methoxypropyl)urea
Modify Date: 2025-08-31 17:08:13
1-(3H-inden-1-yl)-3-(3-methoxypropyl)urea structure
|
Common Name | 1-(3H-inden-1-yl)-3-(3-methoxypropyl)urea | ||
|---|---|---|---|---|
| CAS Number | 20290-38-4 | Molecular Weight | 246.30500 | |
| Density | 1.15g/cm3 | Boiling Point | 402.3ºC at 760 mmHg | |
| Molecular Formula | C14H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.1ºC | |
| Name | 1-(3H-inden-1-yl)-3-(3-methoxypropyl)urea |
|---|
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 402.3ºC at 760 mmHg |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.30500 |
| Flash Point | 197.1ºC |
| Exact Mass | 246.13700 |
| PSA | 53.85000 |
| LogP | 2.51460 |
| Vapour Pressure | 1.11E-06mmHg at 25°C |
| Index of Refraction | 1.573 |
| InChIKey | MLIKFTQSVZGCSD-UHFFFAOYSA-N |
| SMILES | COCCCNC(=O)NC1=CCc2ccccc21 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |