8-Hydroxy-3,5,7,3',4',5'-hexamethoxyflavone structure
|
Common Name | 8-Hydroxy-3,5,7,3',4',5'-hexamethoxyflavone | ||
|---|---|---|---|---|
| CAS Number | 202846-95-5 | Molecular Weight | 418.39 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 630.2±55.0 °C at 760 mmHg | |
| Molecular Formula | C21H22O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.8±25.0 °C | |
Use of 8-Hydroxy-3,5,7,3',4',5'-hexamethoxyflavone8-Hydroxy-3,5,7,3',4',5'-hexamethoxyflavone is a natural flavonoid compound[1]. |
| Name | 8-Hydroxy-3,5,7-trimethoxy-2-(3,4,5-trimethoxyphenyl)-4H-chromen- 4-one |
|---|---|
| Synonym | More Synonyms |
| Description | 8-Hydroxy-3,5,7,3',4',5'-hexamethoxyflavone is a natural flavonoid compound[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 630.2±55.0 °C at 760 mmHg |
| Molecular Formula | C21H22O9 |
| Molecular Weight | 418.39 |
| Flash Point | 220.8±25.0 °C |
| Exact Mass | 418.126373 |
| PSA | 105.82000 |
| LogP | 0.97 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.600 |
| InChIKey | VZZSHWGQMLXLPF-UHFFFAOYSA-N |
| SMILES | COc1cc(-c2oc3c(O)c(OC)cc(OC)c3c(=O)c2OC)cc(OC)c1OC |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2932999099 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 8-Hydroxy-3,5,7-trimethoxy-2-(3,4,5-trimethoxyphenyl)-4H-chromen-4-one |
| 4H-1-Benzopyran-4-one, 8-hydroxy-3,5,7-trimethoxy-2-(3,4,5-trimethoxyphenyl)- |