3,4-Dinitro-6-methoxyaniline structure
|
Common Name | 3,4-Dinitro-6-methoxyaniline | ||
|---|---|---|---|---|
| CAS Number | 20278-59-5 | Molecular Weight | 213.14800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H7N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methoxy-4,5-dinitroaniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H7N3O5 |
|---|---|
| Molecular Weight | 213.14800 |
| Exact Mass | 213.03900 |
| PSA | 126.89000 |
| LogP | 2.72140 |
| InChIKey | RAGDZFDTRGPPFN-UHFFFAOYSA-N |
| SMILES | COc1cc([N+](=O)[O-])c([N+](=O)[O-])cc1N |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3,4-Dinitro-6-methoxyaniline |
| Benzenamine,2-methoxy-4,5-dinitro |