1,1'-Biphenyl,3,3',4,4'-tetramethoxy- structure
|
Common Name | 1,1'-Biphenyl,3,3',4,4'-tetramethoxy- | ||
|---|---|---|---|---|
| CAS Number | 2026-27-9 | Molecular Weight | 274.31200 | |
| Density | 1.094g/cm3 | Boiling Point | 372.9ºC at 760mmHg | |
| Molecular Formula | C16H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 123ºC | |
| Name | 4-(3,4-dimethoxyphenyl)-1,2-dimethoxybenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.094g/cm3 |
|---|---|
| Boiling Point | 372.9ºC at 760mmHg |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.31200 |
| Flash Point | 123ºC |
| Exact Mass | 274.12100 |
| PSA | 36.92000 |
| LogP | 3.38800 |
| Vapour Pressure | 2E-05mmHg at 25°C |
| Index of Refraction | 1.53 |
| InChIKey | ZADYUYOJVLZYAQ-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2ccc(OC)c(OC)c2)cc1OC |
| HS Code | 2909309090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 4 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,1'-biphenyl,3,3',4,4'-tetramethoxy |
| 3,4,3',4'-Tetramethoxy-biphenyl |
| 3,3',4,4'-Tetramethoxy-1,1'-biphenyl |
| 3,3',4,4'-tetramethoxybiphenyl |
| 3.4.3'.4'-Tetramethoxy-diphenyl |
| 3,3',4,4'-tetramethoxylbiphenyl |