1,4-dihydroxy-2-[(3-methoxypropyl)amino]anthraquinone structure
|
Common Name | 1,4-dihydroxy-2-[(3-methoxypropyl)amino]anthraquinone | ||
|---|---|---|---|---|
| CAS Number | 20253-60-5 | Molecular Weight | 327.33100 | |
| Density | 1.415g/cm3 | Boiling Point | 575.3ºC at 760 mmHg | |
| Molecular Formula | C18H17NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 301.7ºC | |
| Name | 1,4-dihydroxy-2-(3-methoxypropylamino)anthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.415g/cm3 |
|---|---|
| Boiling Point | 575.3ºC at 760 mmHg |
| Molecular Formula | C18H17NO5 |
| Molecular Weight | 327.33100 |
| Flash Point | 301.7ºC |
| Exact Mass | 327.11100 |
| PSA | 95.86000 |
| LogP | 2.39460 |
| Vapour Pressure | 7.8E-14mmHg at 25°C |
| Index of Refraction | 1.682 |
| InChIKey | DCFOEKQHOISDOS-UHFFFAOYSA-N |
| SMILES | COCCCNc1cc(O)c2c(c1O)C(=O)c1ccccc1C2=O |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| einecs 243-642-9 |