rac-5-[(2R,5R)-5-hydroxy-2-methylpiperidin-1-yl]furan-2-carbaldehyde
Modify Date: 2026-07-09 19:14:36
![rac-5-[(2R,5R)-5-hydroxy-2-methylpiperidin-1-yl]furan-2-carbaldehyde Structure](https://www.chemsrc.com/extcaspic/103/2024967-57-3.png)
rac-5-[(2R,5R)-5-hydroxy-2-methylpiperidin-1-yl]furan-2-carbaldehyde structure
|
Common Name | rac-5-[(2R,5R)-5-hydroxy-2-methylpiperidin-1-yl]furan-2-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 2024967-57-3 | Molecular Weight | 209.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | rac-5-[(2R,5R)-5-hydroxy-2-methylpiperidin-1-yl]furan-2-carbaldehyde |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H15NO3 |
|---|---|
| Molecular Weight | 209.24 |
| InChIKey | UMDBSPVCCSYDNB-RKDXNWHRSA-N |
| SMILES | CC1CCC(O)CN1c1ccc(C=O)o1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of rac-5-[(2R,5R)-5-hydroxy-2-methylpiperidin-1-yl]furan-2-carbaldehyde? |
| A: CAS number of rac-5-[(2R,5R)-5-hydroxy-2-methylpiperidin-1-yl]furan-2-carbaldehyde is 2024967-57-3. |
| Q: What is the English name of rac-5-[(2R,5R)-5-hydroxy-2-methylpiperidin-1-yl]furan-2-carbaldehyde? |
| A: The English name of rac-5-[(2R,5R)-5-hydroxy-2-methylpiperidin-1-yl]furan-2-carbaldehyde is rac-5-[(2R,5R)-5-hydroxy-2-methylpiperidin-1-yl]furan-2-carbaldehyde. |
| Q: What is the SMILES notation of rac-5-[(2R,5R)-5-hydroxy-2-methylpiperidin-1-yl]furan-2-carbaldehyde? |
| A: SMILES notation of rac-5-[(2R,5R)-5-hydroxy-2-methylpiperidin-1-yl]furan-2-carbaldehyde is CC1CCC(O)CN1c1ccc(C=O)o1. |
| Q: What is the InChIKey of rac-5-[(2R,5R)-5-hydroxy-2-methylpiperidin-1-yl]furan-2-carbaldehyde? |
| A: InChIKey of rac-5-[(2R,5R)-5-hydroxy-2-methylpiperidin-1-yl]furan-2-carbaldehyde is UMDBSPVCCSYDNB-RKDXNWHRSA-N. |
| Q: What is the molecular formula of rac-5-[(2R,5R)-5-hydroxy-2-methylpiperidin-1-yl]furan-2-carbaldehyde? |
| A: Molecular formula of rac-5-[(2R,5R)-5-hydroxy-2-methylpiperidin-1-yl]furan-2-carbaldehyde is C11H15NO3. |
| Q: What is the molecular weight of rac-5-[(2R,5R)-5-hydroxy-2-methylpiperidin-1-yl]furan-2-carbaldehyde? |
| A: Molecular weight of rac-5-[(2R,5R)-5-hydroxy-2-methylpiperidin-1-yl]furan-2-carbaldehyde is 209.24. |
| Q: What is the Chinese name of 2024967-57-3? |
| A: Chinese name of 2024967-57-3 is 2024967-57-3. |