1,4-Cyclohexanedimethanol bis(3,4-epoxycyclohexanecarboxylate)
1,4-Cyclohexanedimethanol bis(3,4-epoxycyclohexanecarboxylate) structure
|
Common Name | 1,4-Cyclohexanedimethanol bis(3,4-epoxycyclohexanecarboxylate) | ||
|---|---|---|---|---|
| CAS Number | 20249-12-1 | Molecular Weight | 392.48600 | |
| Density | 1.203 | Boiling Point | 504.3ºC at 760 mmHg | |
| Molecular Formula | C22H32O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.5ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,4-Cyclohexanedimethanol bis(3,4-epoxycyclohexanecarboxylate) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.203 |
|---|---|
| Boiling Point | 504.3ºC at 760 mmHg |
| Molecular Formula | C22H32O6 |
| Molecular Weight | 392.48600 |
| Flash Point | 218.5ºC |
| Exact Mass | 392.22000 |
| PSA | 77.66000 |
| LogP | 3.01420 |
| Vapour Pressure | 2.7E-10mmHg at 25°C |
| Index of Refraction | 1.526 |
| InChIKey | NRJLSUZLHMXXHJ-UHFFFAOYSA-N |
| SMILES | O=C(OCC1CCC(COC(=O)C2CCC3OC3C2)CC1)C1CCC2OC2C1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2932999099 |
|---|
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 1,4-Cyclohexanedimethanol bis(3,4-epoxycyclohexanecarboxylate)? |
| A: CAS number of 1,4-Cyclohexanedimethanol bis(3,4-epoxycyclohexanecarboxylate) is 20249-12-1. |
| Q: What is the LogP of 1,4-Cyclohexanedimethanol bis(3,4-epoxycyclohexanecarboxylate)? |
| A: LogP of 1,4-Cyclohexanedimethanol bis(3,4-epoxycyclohexanecarboxylate) is 3.01420. |
| Q: What is the polar surface area (PSA) of 1,4-Cyclohexanedimethanol bis(3,4-epoxycyclohexanecarboxylate)? |
| A: Polar surface area (PSA) of 1,4-Cyclohexanedimethanol bis(3,4-epoxycyclohexanecarboxylate) is 77.66000. |
| Q: What is the boiling point of 1,4-Cyclohexanedimethanol bis(3,4-epoxycyclohexanecarboxylate)? |
| A: Boiling point of 1,4-Cyclohexanedimethanol bis(3,4-epoxycyclohexanecarboxylate) is 504.3ºC at 760 mmHg. |
| Q: What is the InChIKey of 1,4-Cyclohexanedimethanol bis(3,4-epoxycyclohexanecarboxylate)? |
| A: InChIKey of 1,4-Cyclohexanedimethanol bis(3,4-epoxycyclohexanecarboxylate) is NRJLSUZLHMXXHJ-UHFFFAOYSA-N. |
| Q: What is the English name of 1,4-Cyclohexanedimethanol bis(3,4-epoxycyclohexanecarboxylate)? |
| A: The English name of 1,4-Cyclohexanedimethanol bis(3,4-epoxycyclohexanecarboxylate) is 1,4-Cyclohexanedimethanol bis(3,4-epoxycyclohexanecarboxylate). |
| Q: What is the SMILES notation of 1,4-Cyclohexanedimethanol bis(3,4-epoxycyclohexanecarboxylate)? |
| A: SMILES notation of 1,4-Cyclohexanedimethanol bis(3,4-epoxycyclohexanecarboxylate) is O=C(OCC1CCC(COC(=O)C2CCC3OC3C2)CC1)C1CCC2OC2C1. |
| Q: What is the molecular formula of 1,4-Cyclohexanedimethanol bis(3,4-epoxycyclohexanecarboxylate)? |
| A: Molecular formula of 1,4-Cyclohexanedimethanol bis(3,4-epoxycyclohexanecarboxylate) is C22H32O6. |
| Q: What is the molecular weight of 1,4-Cyclohexanedimethanol bis(3,4-epoxycyclohexanecarboxylate)? |
| A: Molecular weight of 1,4-Cyclohexanedimethanol bis(3,4-epoxycyclohexanecarboxylate) is 392.48600. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |
| Henan Tianfu Chemical Co., Ltd. |