2,4,4,6-Tetrachloro-2,5-cyclohexadien-1-one structure
|
Common Name | 2,4,4,6-Tetrachloro-2,5-cyclohexadien-1-one | ||
|---|---|---|---|---|
| CAS Number | 20244-55-7 | Molecular Weight | 231.89100 | |
| Density | 1.66g/cm3 | Boiling Point | 350ºC at 760 mmHg | |
| Molecular Formula | C6H2Cl4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.8ºC | |
| Name | 2,4,4,6-tetrachlorocyclohexa-2,5-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.66g/cm3 |
|---|---|
| Boiling Point | 350ºC at 760 mmHg |
| Molecular Formula | C6H2Cl4O |
| Molecular Weight | 231.89100 |
| Flash Point | 147.8ºC |
| Exact Mass | 229.88600 |
| PSA | 17.07000 |
| LogP | 2.98840 |
| Vapour Pressure | 4.53E-05mmHg at 25°C |
| Index of Refraction | 1.582 |
| InChIKey | PCZOCOUKAYTNJX-UHFFFAOYSA-N |
| SMILES | O=C1C(Cl)=CC(Cl)(Cl)C=C1Cl |
| HS Code | 2914700090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 4 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Trichlorphenolchlor |
| 2,4,4,6-Tetrachloro-2,5-cyclohexadien-1-one |
| 2,4,4,6-Tetrachlor-cyclohexa-2,5-dienon |
| 2,4,4,6-tetrachloro-cyclohexa-2,5-dienone |
| 2,4,4,6-tetrachloro-2,5-cyclohexadienone |