4,4'-bis[[6-anilino-4-[bis(2-hydroxyethyl)amino]-1,3,5-triazin-2-yl]amino]stilbene-2,2'-disulphonic acid, compound with 2-aminoethanol (1:2) structure
|
Common Name | 4,4'-bis[[6-anilino-4-[bis(2-hydroxyethyl)amino]-1,3,5-triazin-2-yl]amino]stilbene-2,2'-disulphonic acid, compound with 2-aminoethanol (1:2) | ||
|---|---|---|---|---|
| CAS Number | 20206-64-8 | Molecular Weight | 1039.15000 | |
| Density | N/A | Boiling Point | 1335.4ºC at 760 mmHg | |
| Molecular Formula | C44H58N14O12S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 761.4ºC | |
| Name | 2-aminoethanol,5-[[4-anilino-6-[bis(2-hydroxyethyl)amino]-1,3,5-triazin-2-yl]amino]-2-[(E)-2-[4-[[4-anilino-6-[bis(2-hydroxyethyl)amino]-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid |
|---|
| Boiling Point | 1335.4ºC at 760 mmHg |
|---|---|
| Molecular Formula | C44H58N14O12S2 |
| Molecular Weight | 1039.15000 |
| Flash Point | 761.4ºC |
| Exact Mass | 1038.38000 |
| PSA | 443.78000 |
| LogP | 2.40140 |
| Vapour Pressure | 0mmHg at 25°C |
| InChIKey | KVSBGSSSADXAIS-UHFFFAOYSA-N |
| SMILES | NCCO.NCCO.O=S(=O)(O)c1cc(Nc2nc(Nc3ccccc3)nc(N(CCO)CCO)n2)ccc1C=Cc1ccc(Nc2nc(Nc3ccccc3)nc(N(CCO)CCO)n2)cc1S(=O)(=O)O |