2-methoxy-4-(5,6,6-trimethylbicyclo[2.2.1]hept-2-yl)phenol structure
|
Common Name | 2-methoxy-4-(5,6,6-trimethylbicyclo[2.2.1]hept-2-yl)phenol | ||
|---|---|---|---|---|
| CAS Number | 20201-60-9 | Molecular Weight | 260.37100 | |
| Density | 1.04g/cm3 | Boiling Point | 362.7ºC at 760 mmHg | |
| Molecular Formula | C17H24O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.3ºC | |
| Name | 2-methoxy-4-(2,3,3-trimethyl-5-bicyclo[2.2.1]heptanyl)phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.04g/cm3 |
|---|---|
| Boiling Point | 362.7ºC at 760 mmHg |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.37100 |
| Flash Point | 153.3ºC |
| Exact Mass | 260.17800 |
| PSA | 29.46000 |
| LogP | 4.18650 |
| Vapour Pressure | 9.09E-06mmHg at 25°C |
| Index of Refraction | 1.53 |
| InChIKey | ZDDMXFRCSRMVFF-UHFFFAOYSA-N |
| SMILES | COc1cc(C2CC3CC2C(C)(C)C3C)ccc1O |
| HS Code | 2909500000 |
|---|
| HS Code | 2909500000 |
|---|---|
| Summary | 2909500000 ether-phenols, ether-alcohol-phenols and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| einecs 243-588-6 |