N-acetyl-L-cysteine, compound with [R-(R*,R*)]-2-[(dichloroacetyl)amino]-3-hydroxy-3-[4-mesylphenyl]propyl glycinate (1:1) structure
|
Common Name | N-acetyl-L-cysteine, compound with [R-(R*,R*)]-2-[(dichloroacetyl)amino]-3-hydroxy-3-[4-mesylphenyl]propyl glycinate (1:1) | ||
|---|---|---|---|---|
| CAS Number | 20192-91-0 | Molecular Weight | 576.46800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H27Cl2N3O9S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2R)-2-acetamido-3-sulfanylpropanoic acid,[(2R,3R)-2-[(2,2-dichloroacetyl)amino]-3-hydroxy-3-(4-methylsulfonylphenyl)propyl] 2-aminoacetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H27Cl2N3O9S2 |
|---|---|
| Molecular Weight | 576.46800 |
| Exact Mass | 575.05700 |
| PSA | 256.35000 |
| LogP | 2.88110 |
| InChIKey | PEGBMQRZXOKYCO-XGBIXHFLSA-N |
| SMILES | CC(=O)NC(CS)C(=O)O.CS(=O)(=O)c1ccc(C(O)C(COC(=O)CN)NC(=O)C(Cl)Cl)cc1 |
| N-Acetyl-L-cysteine,compound with (R-(R*,R*))-2-((dichloroacetyl)amino)-3-hydroxy-3-(4-mesylphenyl)propyl glycinate (1:1) |
| EINECS 243-572-9 |