Glycerophospho-N-Oleoyl Ethanolamine structure
|
Common Name | Glycerophospho-N-Oleoyl Ethanolamine | ||
|---|---|---|---|---|
| CAS Number | 201738-24-1 | Molecular Weight | 479.588 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C23H46NO7P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Glycerophospho-N-Oleoyl EthanolamineGlycerophospho-N-oleoyl ethanolamine is the precursor of oleoyl ethanolamide (OEA). OEA is an endogenous, potent agonist for PPARα. |
| Name | 2,3-dihydroxypropyl 2-(octadec-9-enoylamino)ethyl hydrogen phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Molecular Formula | C23H46NO7P |
| Molecular Weight | 479.588 |
| Exact Mass | 479.301178 |
| PSA | 135.13000 |
| LogP | 4.79 |
| Index of Refraction | 1.493 |
| InChIKey | VBNXVCGZJCGEKO-KTKRTIGZSA-N |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)NCCOP(=O)(O)OCC(O)CO |
| Phosphoric acid, 2,3-dihydroxypropyl 2-[[(9Z)-1-oxo-9-octadecen-1-yl]amino]ethyl ester |
| Glycerophospho-N-Oleoyl Ethanolamine |
| 2,3-Dihydroxypropyl 2-[(9Z)-9-octadecenoylamino]ethyl hydrogen phosphate |