Difenamizole structure
|
Common Name | Difenamizole | ||
|---|---|---|---|---|
| CAS Number | 20170-20-1 | Molecular Weight | 334.41500 | |
| Density | 1.13g/cm3 | Boiling Point | 543.6ºC at 760mmHg | |
| Molecular Formula | C20H22N4O | Melting Point | 123-128°; mp 120-122° | |
| MSDS | N/A | Flash Point | 282.6ºC | |
| Name | N-(1,3-Diphenyl-1H-pyrazol-5-yl)-N2,N2-dimethylalaninamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 543.6ºC at 760mmHg |
| Melting Point | 123-128°; mp 120-122° |
| Molecular Formula | C20H22N4O |
| Molecular Weight | 334.41500 |
| Flash Point | 282.6ºC |
| Exact Mass | 334.17900 |
| PSA | 50.16000 |
| LogP | 3.50090 |
| Vapour Pressure | 7.07E-12mmHg at 25°C |
| Index of Refraction | 1.604 |
| InChIKey | PCXMKBOWWVXEDT-UHFFFAOYSA-N |
| SMILES | CC(C(=O)Nc1cc(-c2ccccc2)nn1-c1ccccc1)N(C)C |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Diphenacin |
| Promar |
| (2-diphenylacetyl)indan-1,3-dione |
| 2-diphenylacetyl-1,3-indandione |
| Difenamizole |
| diphenadione |
| Diphenadion |
| Oragulant |
| difenadione |
| Didandin |
| 2-(diphenylacetyl)indandione-1,3 |
| Diphacinone |
| N,N-dimethyl-alanine 2,5-diphenyl-2H-pyrazol-3-ylamide |
| 2-(diphenylacetyl)indanedione-1,3 |
| Diphenandione |
| Dipaxin |
| Diphacin |