4-[(E)-3-phenylprop-2-enoyl]benzoic acid
Modify Date: 2025-10-08 16:30:57
![4-[(E)-3-phenylprop-2-enoyl]benzoic acid Structure](https://image.chemsrc.com/caspic/068/20118-35-8.png)
4-[(E)-3-phenylprop-2-enoyl]benzoic acid structure
|
Common Name | 4-[(E)-3-phenylprop-2-enoyl]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 20118-35-8 | Molecular Weight | 252.26500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[(E)-3-phenylprop-2-enoyl]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H12O3 |
|---|---|
| Molecular Weight | 252.26500 |
| Exact Mass | 252.07900 |
| PSA | 54.37000 |
| LogP | 3.28090 |
| InChIKey | XXFQFMHIIWSQAL-IZZDOVSWSA-N |
| SMILES | O=C(O)c1ccc(C(=O)C=Cc2ccccc2)cc1 |
| HS Code | 2916399090 |
|---|
|
~%
4-[(E)-3-phenyl... CAS#:20118-35-8 |
| Literature: Katritzky, Alan R.; Yang, Yu-Kun; Gabrielsen, Bjarne; Marquet, Jorge Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1984 , p. 857 - 866 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-cinnamoyl-benzoic acid |
| 3-Oxo-1-phenyl-3-(4-carboxy-phenyl)-propen-(1) |
| 4-((2E)-3-phenylprop-2-enoyl)benzoic acid |
| 4-Cinnamoyl-benzoesaeure |
| 4'-carboxylchalcone |
| Chalkon-carbonsaeure-(4') |
| 4-(3-Phenylprop-2-enoyl)benzoic acid |