CGP 64213
Modify Date: 2025-08-25 23:27:02
CGP 64213 structure
|
Common Name | CGP 64213 | ||
|---|---|---|---|---|
| CAS Number | 200402-50-2 | Molecular Weight | 646.45 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H36IN2O7P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of CGP 64213CGP 64213 is a GABAb receptor agonist. |
| Name | CGP 64213 |
|---|
| Description | CGP 64213 is a GABAb receptor agonist. |
|---|---|
| References | 1. Duthey B, Caudron S, Perroy J, Bettler B, Fagni L, Pin JP, Prézeau L. A single subunit (GB2) is required for G-protein activation by the heterodimeric GABA(B) receptor. J Biol Chem. 2002 Feb 1;277(5):3236-41. PubMed PMID: 11711539; PubMed Central PMCID: PMC2566549. |
| Molecular Formula | C26H36IN2O7P |
|---|---|
| Molecular Weight | 646.45 |
| InChIKey | RLYLJDJFHZHCTR-GCJKJVERSA-N |
| SMILES | CC(NCC(O)CP(=O)(O)CCCCCNC(=O)CCc1ccc(O)c(I)c1)c1cccc(C(=O)O)c1 |