n-acetyl-d-ala-d-ala structure
|
Common Name | n-acetyl-d-ala-d-ala | ||
|---|---|---|---|---|
| CAS Number | 19993-26-1 | Molecular Weight | 202.20800 | |
| Density | 1.204g/cm3 | Boiling Point | 543.6ºC at 760 mmHg | |
| Molecular Formula | C8H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 282.5ºC | |
| Name | n-acetyl-d-ala-d-ala |
|---|---|
| Synonym | More Synonyms |
| Density | 1.204g/cm3 |
|---|---|
| Boiling Point | 543.6ºC at 760 mmHg |
| Molecular Formula | C8H14N2O4 |
| Molecular Weight | 202.20800 |
| Flash Point | 282.5ºC |
| Exact Mass | 202.09500 |
| PSA | 95.50000 |
| Vapour Pressure | 2.96E-13mmHg at 25°C |
| Index of Refraction | 1.481 |
| InChIKey | MJZMSEWWBGCBFM-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(C)C(=O)NC(C)C(=O)O |
| Storage condition | −20°C |
| HS Code | 2924199090 |
|---|
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Cyclopentyl-methyl-keton-2,4-dinitrophenylhydrazon |
| 2,4-Dinitrophenylhydrazon v. Cyclopentyl-methyl-keton |
| N-Ac-D-Ala-D-Ala |
| acetylcyclopentane 2,4-dinitrophenylhydrazone |
| N-acetyl-D-alanyl-D-alanine |
| 2,4-Dinitrophenylhydrazon von Cyclopentyl-methyl-keton |
| Ac-D-Ala-D-Ala-OH |
| acetyl-D-alanyl-D-alanine |