2-methoxysulfonyl-1,1-diphenyl-ethanol structure
|
Common Name | 2-methoxysulfonyl-1,1-diphenyl-ethanol | ||
|---|---|---|---|---|
| CAS Number | 19977-47-0 | Molecular Weight | 292.35000 | |
| Density | 1.284g/cm3 | Boiling Point | 516.2ºC at 760 mmHg | |
| Molecular Formula | C15H16O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266ºC | |
| Name | methyl 2-hydroxy-2,2-diphenylethanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.284g/cm3 |
|---|---|
| Boiling Point | 516.2ºC at 760 mmHg |
| Molecular Formula | C15H16O4S |
| Molecular Weight | 292.35000 |
| Flash Point | 266ºC |
| Exact Mass | 292.07700 |
| PSA | 71.98000 |
| LogP | 2.97950 |
| Vapour Pressure | 1.75E-11mmHg at 25°C |
| Index of Refraction | 1.596 |
| InChIKey | FKOSJZZMOHBEJQ-UHFFFAOYSA-N |
| SMILES | COS(=O)(=O)CC(O)(c1ccccc1)c1ccccc1 |
|
~%
2-methoxysulfon... CAS#:19977-47-0 |
| Literature: Corey,E.J.; Durst,T. Journal of the American Chemical Society, 1968 , vol. 90, p. 5548 - 5552 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2.2-Diphenyl-2-hydroxy-ethansulfonsaeuremethylester |