2-fluoro-6-(naphthalene-2-carbonyl)benzoic acid structure
|
Common Name | 2-fluoro-6-(naphthalene-2-carbonyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 1993-97-1 | Molecular Weight | 294.27700 | |
| Density | 1.347g/cm3 | Boiling Point | 528.8ºC at 760 mmHg | |
| Molecular Formula | C18H11FO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.6ºC | |
| Name | 2-fluoro-6-(naphthalene-2-carbonyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.347g/cm3 |
|---|---|
| Boiling Point | 528.8ºC at 760 mmHg |
| Molecular Formula | C18H11FO3 |
| Molecular Weight | 294.27700 |
| Flash Point | 273.6ºC |
| Exact Mass | 294.06900 |
| PSA | 54.37000 |
| LogP | 3.90810 |
| Vapour Pressure | 5.21E-12mmHg at 25°C |
| Index of Refraction | 1.661 |
| InChIKey | IZZWXQCIMVPLIK-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc2ccccc2c1)c1cccc(F)c1C(=O)O |
| Mixture of Regioisomers |
| 2-fluoro-6-(naphthalen-2-ylcarbonyl)benzoic acid |
| 6-Fluor-2-(naphtho-2-yl)-benzoesaeure |