1,1'-(2-methyl-1,3-phenylene)bis-1H-pyrrole-2,5-dione structure
|
Common Name | 1,1'-(2-methyl-1,3-phenylene)bis-1H-pyrrole-2,5-dione | ||
|---|---|---|---|---|
| CAS Number | 19896-17-4 | Molecular Weight | 282.25100 | |
| Density | 1.506g/cm3 | Boiling Point | 496.5ºC at 760mmHg | |
| Molecular Formula | C15H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243ºC | |
| Name | 1-[3-(2,5-dioxopyrrol-1-yl)-2-methylphenyl]pyrrole-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.506g/cm3 |
|---|---|
| Boiling Point | 496.5ºC at 760mmHg |
| Molecular Formula | C15H10N2O4 |
| Molecular Weight | 282.25100 |
| Flash Point | 243ºC |
| Exact Mass | 282.06400 |
| PSA | 74.76000 |
| LogP | 0.98380 |
| Vapour Pressure | 5.37E-10mmHg at 25°C |
| Index of Refraction | 1.685 |
| InChIKey | LNAIBNHJQKDBNR-UHFFFAOYSA-N |
| SMILES | Cc1c(N2C(=O)C=CC2=O)cccc1N1C(=O)C=CC1=O |
| HS Code | 2925190090 |
|---|
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| einecs 243-412-8 |