diethyl (E)-(3,7-dimethyl-2,6-octadienyl)malonate structure
|
Common Name | diethyl (E)-(3,7-dimethyl-2,6-octadienyl)malonate | ||
|---|---|---|---|---|
| CAS Number | 19894-79-2 | Molecular Weight | 296.40200 | |
| Density | 0.977g/cm3 | Boiling Point | 351.1ºC at 760mmHg | |
| Molecular Formula | C17H28O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160.8ºC | |
| Name | diethyl 2-(3,7-dimethylocta-2,6-dienyl)propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.977g/cm3 |
|---|---|
| Boiling Point | 351.1ºC at 760mmHg |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.40200 |
| Flash Point | 160.8ºC |
| Exact Mass | 296.19900 |
| PSA | 52.60000 |
| LogP | 3.81160 |
| Vapour Pressure | 4.22E-05mmHg at 25°C |
| Index of Refraction | 1.466 |
| InChIKey | CNARYHFSSZYVQJ-SDNWHVSQSA-N |
| SMILES | CCOC(=O)C(CC=C(C)CCC=C(C)C)C(=O)OCC |
| HS Code | 2917190090 |
|---|
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| diethyl geranylmalonate |