Aranotine
Modify Date: 2025-08-25 13:18:34
Aranotine structure
|
Common Name | Aranotine | ||
|---|---|---|---|---|
| CAS Number | 19885-51-9 | Molecular Weight | 462.49600 | |
| Density | 1.72g/cm3 | Boiling Point | 853.6ºC at 760 mmHg | |
| Molecular Formula | C20H18N2O7S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 470.1ºC | |
Use of AranotineAranotin strongly binds to Nsp15 viral protein. Aranotin can be used as promising SARS-CoV-2 replication strong inhibitor. Aranotin has the potential for COVID-19 research[1]. |
| Name | aranotin |
|---|---|
| Synonym | More Synonyms |
| Description | Aranotin strongly binds to Nsp15 viral protein. Aranotin can be used as promising SARS-CoV-2 replication strong inhibitor. Aranotin has the potential for COVID-19 research[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.72g/cm3 |
|---|---|
| Boiling Point | 853.6ºC at 760 mmHg |
| Molecular Formula | C20H18N2O7S2 |
| Molecular Weight | 462.49600 |
| Flash Point | 470.1ºC |
| Exact Mass | 462.05600 |
| PSA | 156.21000 |
| LogP | 1.01340 |
| Vapour Pressure | 6.39E-34mmHg at 25°C |
| Index of Refraction | 1.781 |
| InChIKey | HXWOWBFXYUFFKS-PSJNWGMYSA-N |
| SMILES | CC(=O)OC1C=COC=C2CC34SSC5(CC6=COC=CC(O)C6N5C3=O)C(=O)N4C21 |
| RIDADR | UN 1544 |
|---|---|
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| (7aR)-5t-acetoxy-13t-hydroxy-(5at,13at)-5,5a,13,13a-tetrahydro-8H,16H-7ar,15ac-epidisulfano-bis(oxepino[3',4':4,5]pyrrolo)[1,2-a,1',2'-d]pyrazine-7,15-dione |
| Aranotine [INN-French] |
| Ariotin |
| Aranotina [INN-Spanish] |
| Aranotinum [INN-Latin] |