1,4-bis(2-ethylaminoethylamino)anthracene-9,10-dione structure
|
Common Name | 1,4-bis(2-ethylaminoethylamino)anthracene-9,10-dione | ||
|---|---|---|---|---|
| CAS Number | 19853-97-5 | Molecular Weight | 380.48300 | |
| Density | 1.209g/cm3 | Boiling Point | 611.1ºC at 760 mmHg | |
| Molecular Formula | C22H28N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196ºC | |
| Name | 1,4-bis[2-(ethylamino)ethylamino]anthracene-9,10-dione |
|---|
| Density | 1.209g/cm3 |
|---|---|
| Boiling Point | 611.1ºC at 760 mmHg |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.48300 |
| Flash Point | 196ºC |
| Exact Mass | 380.22100 |
| PSA | 82.26000 |
| LogP | 3.43260 |
| Vapour Pressure | 7.16E-15mmHg at 25°C |
| Index of Refraction | 1.636 |
| InChIKey | MHUNHBNDEOFKCV-UHFFFAOYSA-N |
| SMILES | CCNCCNc1ccc(NCCNCC)c2c1C(=O)c1ccccc1C2=O |
|
~%
1,4-bis(2-ethyl... CAS#:19853-97-5 |
| Literature: Greenhalgh,C.W.; Hughes,N. Journal of the Chemical Society [Section] C: Organic, 1968 , p. 1284 - 1288 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |