Adamantan-1-ylacetyl chloride structure
|
Common Name | Adamantan-1-ylacetyl chloride | ||
|---|---|---|---|---|
| CAS Number | 19835-38-2 | Molecular Weight | 212.716 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 281.1±9.0 °C at 760 mmHg | |
| Molecular Formula | C12H17ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 126.0±11.9 °C | |
| Name | 2-(1-adamantyl)acetyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 281.1±9.0 °C at 760 mmHg |
| Molecular Formula | C12H17ClO |
| Molecular Weight | 212.716 |
| Flash Point | 126.0±11.9 °C |
| Exact Mass | 212.096786 |
| PSA | 17.07000 |
| LogP | 3.87 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.537 |
| InChIKey | HLQSEJBREPQBRW-UHFFFAOYSA-N |
| SMILES | O=C(Cl)CC12CC3CC(CC(C3)C1)C2 |
| HS Code | 2915900090 |
|---|
|
~10%
Adamantan-1-yla... CAS#:19835-38-2 |
| Literature: STERIX LIMITED Patent: WO2006/100502 A1, 2006 ; Location in patent: Page/Page column 86 ; |
| Precursor 1 | |
|---|---|
| DownStream 8 | |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| Tricyclo[3.3.1.1]decane-1-acetyl chloride |
| 1-Adamantaneacetylchloride |
| 1-adamantaneacetic acid chloride |
| adamantane-1-yl-acetyl chloride |
| Adamantan-1-ylacetyl chloride |
| tricyclo[3.3.1.1]dec-1-ylacetyl chloride |
| 1-adamantanemethanecarbonyl chloride |
| 1-adamantylacetyl chloride |
| 1-adamantylacetic acid chloride |