1,2-Bis(4-bromophenyl)ethane
1,2-Bis(4-bromophenyl)ethane structure
|
Common Name | 1,2-Bis(4-bromophenyl)ethane | ||
|---|---|---|---|---|
| CAS Number | 19829-56-2 | Molecular Weight | 340.05300 | |
| Density | N/A | Boiling Point | 198°C/10mmHg(lit.) | |
| Molecular Formula | C14H12Br2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 1,2-Bis(4-bromophenyl)ethane, also known as 1-bromo-4-[2-(4-bromophenyl)ethyl]benzene, Chinese name 1,2-双(4-溴苯基)乙烷, CAS number 19829-56-2, molecular formula C14H12Br2, molecular weight 340.05300. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-bromo-4-[2-(4-bromophenyl)ethyl]benzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Boiling Point | 198°C/10mmHg(lit.) |
|---|---|
| Molecular Formula | C14H12Br2 |
| Molecular Weight | 340.05300 |
| Exact Mass | 337.93100 |
| LogP | 4.99680 |
| InChIKey | XDRPVMCAFPGETC-UHFFFAOYSA-N |
| SMILES | Brc1ccc(CCc2ccc(Br)cc2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 3 | |
CAS#:589-15-1
CAS#:589-17-3
CAS#:55883-45-9
CAS#:201230-82-2
CAS#:18869-30-2
CAS#:103-29-7
CAS#:78808-28-3
CAS#:19552-10-4
CAS#:98-59-9
CAS#:57239-56-2
CAS#:5216-37-5![4-[2-(4-formylphenyl)ethyl]benzaldehyde structure](https://image.chemsrc.com/caspic/075/1220-08-2.png)
CAS#:1220-08-2
CAS#:40642-10-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,1'-ethane-1,2-diylbis(4-bromobenzene) |
| 1,2-bis-(p-bromophenyl)ethane |
| 4,4'-dibromobibenzyl |
| 1,1'-(1,2-ethanediyl)bis[4-bromobenzene] |
| 1,2-di-(p-bromophenyl)ethane |
| bis(4-bromophenyl)ethane |
| 1,2-BIS(4-BROMOPHENYL)ETHANE |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1-bromo-4-[2-(4-bromophenyl)ethyl]benzene? |
| A: InChIKey of 1-bromo-4-[2-(4-bromophenyl)ethyl]benzene is XDRPVMCAFPGETC-UHFFFAOYSA-N. |
| Q: What English synonyms does 1-bromo-4-[2-(4-bromophenyl)ethyl]benzene have? |
| A: English synonyms of 1-bromo-4-[2-(4-bromophenyl)ethyl]benzene: 1,1'-ethane-1,2-diylbis(4-bromobenzene), 1,2-bis-(p-bromophenyl)ethane, 4,4'-dibromobibenzyl, 1,1'-(1,2-ethanediyl)bis[4-bromobenzene], 1,2-di-(p-bromophenyl)ethane, bis(4-bromophenyl)ethane, 1,2-BIS(4-BROMOPHENYL)ETHANE. |
| Q: What is the English name of 1-bromo-4-[2-(4-bromophenyl)ethyl]benzene? |
| A: The English name of 1-bromo-4-[2-(4-bromophenyl)ethyl]benzene is 1-bromo-4-[2-(4-bromophenyl)ethyl]benzene. |
| Q: What is the molecular formula of 1-bromo-4-[2-(4-bromophenyl)ethyl]benzene? |
| A: Molecular formula of 1-bromo-4-[2-(4-bromophenyl)ethyl]benzene is C14H12Br2. |
| Q: What is the SMILES notation of 1-bromo-4-[2-(4-bromophenyl)ethyl]benzene? |
| A: SMILES notation of 1-bromo-4-[2-(4-bromophenyl)ethyl]benzene is Brc1ccc(CCc2ccc(Br)cc2)cc1. |
| Q: What is the LogP of 1-bromo-4-[2-(4-bromophenyl)ethyl]benzene? |
| A: LogP of 1-bromo-4-[2-(4-bromophenyl)ethyl]benzene is 4.99680. |
| Q: What is the CAS number of 1-bromo-4-[2-(4-bromophenyl)ethyl]benzene? |
| A: CAS number of 1-bromo-4-[2-(4-bromophenyl)ethyl]benzene is 19829-56-2. |
| Q: What are the upstream materials of 1-bromo-4-[2-(4-bromophenyl)ethyl]benzene? |
| A: Related upstream materials(CAS) of 1-bromo-4-[2-(4-bromophenyl)ethyl]benzene: 589-15-1;589-17-3;55883-45-9;201230-82-2;18869-30-2;103-29-7;78808-28-3;19552-10-4;98-59-9;57239-56-2. |
| Q: What is the molecular weight of 1-bromo-4-[2-(4-bromophenyl)ethyl]benzene? |
| A: Molecular weight of 1-bromo-4-[2-(4-bromophenyl)ethyl]benzene is 340.05300. |
| Q: What is the boiling point of 1-bromo-4-[2-(4-bromophenyl)ethyl]benzene? |
| A: Boiling point of 1-bromo-4-[2-(4-bromophenyl)ethyl]benzene is 198°C/10mmHg(lit.). |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |