6-butyl-4-hydroxy-3-methoxycarbonyl-7-beta-phenoxyethoxyquinoline
Modify Date: 2025-08-25 10:01:35
6-butyl-4-hydroxy-3-methoxycarbonyl-7-beta-phenoxyethoxyquinoline structure
|
Common Name | 6-butyl-4-hydroxy-3-methoxycarbonyl-7-beta-phenoxyethoxyquinoline | ||
|---|---|---|---|---|
| CAS Number | 19828-70-7 | Molecular Weight | 395.44800 | |
| Density | 1.189g/cm3 | Boiling Point | 560.3ºC at 760 mmHg | |
| Molecular Formula | C23H25NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 292.7ºC | |
| Name | methyl 6-butyl-4-oxo-7-(2-phenoxyethoxy)-1H-quinoline-3-carboxylate |
|---|
| Density | 1.189g/cm3 |
|---|---|
| Boiling Point | 560.3ºC at 760 mmHg |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.44800 |
| Flash Point | 292.7ºC |
| Exact Mass | 395.17300 |
| PSA | 77.62000 |
| LogP | 4.11510 |
| Vapour Pressure | 1.39E-12mmHg at 25°C |
| Index of Refraction | 1.568 |
| InChIKey | RRISVJICBWWKJG-UHFFFAOYSA-N |
| SMILES | CCCCc1cc2c(=O)c(C(=O)OC)c[nH]c2cc1OCCOc1ccccc1 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |