2-Furancarboxamide,N-(3-chloro-4-methylphenyl)- structure
|
Common Name | 2-Furancarboxamide,N-(3-chloro-4-methylphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 1982-63-4 | Molecular Weight | 235.66600 | |
| Density | 1.314g/cm3 | Boiling Point | 266.1ºC at 760mmHg | |
| Molecular Formula | C12H10ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 114.7ºC | |
| Name | N-(3-chloro-4-methylphenyl)furan-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.314g/cm3 |
|---|---|
| Boiling Point | 266.1ºC at 760mmHg |
| Molecular Formula | C12H10ClNO2 |
| Molecular Weight | 235.66600 |
| Flash Point | 114.7ºC |
| Exact Mass | 235.04000 |
| PSA | 42.24000 |
| LogP | 3.56670 |
| Vapour Pressure | 0.00882mmHg at 25°C |
| Index of Refraction | 1.618 |
| InChIKey | CZIKLJHXDRQDBO-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NC(=O)c2ccco2)cc1Cl |
| HS Code | 2932190090 |
|---|
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| hms1425o05 |