N-(3-Bromophenyl)-4-fluorobenzamide structure
|
Common Name | N-(3-Bromophenyl)-4-fluorobenzamide | ||
|---|---|---|---|---|
| CAS Number | 1978-81-0 | Molecular Weight | 294.11900 | |
| Density | 1.558g/cm3 | Boiling Point | 301.5ºC at 760 mmHg | |
| Molecular Formula | C13H9BrFNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.1ºC | |
| Name | N-(3-Bromophenyl)-4-fluorobenzamide |
|---|
| Density | 1.558g/cm3 |
|---|---|
| Boiling Point | 301.5ºC at 760 mmHg |
| Molecular Formula | C13H9BrFNO |
| Molecular Weight | 294.11900 |
| Flash Point | 136.1ºC |
| Exact Mass | 292.98500 |
| PSA | 29.10000 |
| LogP | 3.91350 |
| Vapour Pressure | 0.00105mmHg at 25°C |
| Index of Refraction | 1.646 |
| InChIKey | WGLIIBHCSORMDW-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cccc(Br)c1)c1ccc(F)cc1 |
| HS Code | 2924299090 |
|---|
|
~%
N-(3-Bromopheny... CAS#:1978-81-0 |
| Literature: Nayak, Susanta K.; Kishore Reddy; Row, Tayur N. Guru; Chopra, Deepak Crystal Growth and Design, 2011 , vol. 11, # 5 p. 1578 - 1596 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |